C19H19NO3S — CID 10947841
[(3S)-1-benzyl-5-oxo-2-phenylsulfanylpyrrolidin-3-yl] acetate (PubChem CID 10947841) has the molecular formula C19H19NO3S and a molecular weight of 341.43 g/mol. Its IUPAC name is [(3S)-1-benzyl-5-oxo-2-phenylsulfanylpyrrolidin-3-yl] acetate.
| Compound Name | [(3S)-1-benzyl-5-oxo-2-phenylsulfanylpyrrolidin-3-yl] acetate |
|---|---|
| PubChem CID | 10947841 |
| Molecular Formula | C19H19NO3S |
| Molecular Weight | 341.43 g/mol |
| Exact Mass | 341.11 |
| IUPAC Name | [(3S)-1-benzyl-5-oxo-2-phenylsulfanylpyrrolidin-3-yl] acetate |
| SMILES | CC(=O)O[C@H]1CC(=O)N(Cc2ccccc2)C1Sc1ccccc1 |
| InChI | InChI=1S/C19H19NO3S/c1-14(21)23-17-12-18(22)20(13-15-8-4-2-5-9-15)19(17)24-16-10-6-3-7-11-16/h2-11,17,19H,12-13H2,1H3/t17-,19?/m0/s1 |
| InChIKey | LOVWWFKZGJINGS-KKFHFHRHSA-N |
| XLogP | 3.47 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.43 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |