C19H21NO2S — CID 134864004
(4S,5R)-1-benzyl-5-[dimethylidene(phenyl)-λ6-sulfanyl]-4-hydroxypyrrolidin-2-one (PubChem CID 134864004) has the molecular formula C19H21NO2S and a molecular weight of 327.45 g/mol. Its IUPAC name is (4S,5R)-1-benzyl-5-[dimethylidene(phenyl)-λ6-sulfanyl]-4-hydroxypyrrolidin-2-one.
| Compound Name | (4S,5R)-1-benzyl-5-[dimethylidene(phenyl)-λ6-sulfanyl]-4-hydroxypyrrolidin-2-one |
|---|---|
| PubChem CID | 134864004 |
| Molecular Formula | C19H21NO2S |
| Molecular Weight | 327.45 g/mol |
| Exact Mass | 327.13 |
| IUPAC Name | (4S,5R)-1-benzyl-5-[dimethylidene(phenyl)-λ6-sulfanyl]-4-hydroxypyrrolidin-2-one |
| SMILES | C=S(=C)(c1ccccc1)[C@@H]1[C@@H](O)CC(=O)N1Cc1ccccc1 |
| InChI | InChI=1S/C19H21NO2S/c1-23(2,16-11-7-4-8-12-16)19-17(21)13-18(22)20(19)14-15-9-5-3-6-10-15/h3-12,17,19,21H,1-2,13-14H2/t17-,19+/m0/s1 |
| InChIKey | UHQWPSDPPLPKTJ-PKOBYXMFSA-N |
| XLogP | 2.83 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.45 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|