C18H18FNO2S — CID 111561702
2-(4-fluorophenyl)sulfanyl-1-[(3R)-3-hydroxypyrrolidin-1-yl]-2-phenylethanone (PubChem CID 111561702) has the molecular formula C18H18FNO2S and a molecular weight of 331.41 g/mol. Its IUPAC name is 2-(4-fluorophenyl)sulfanyl-1-[(3R)-3-hydroxypyrrolidin-1-yl]-2-phenylethanone.
| Compound Name | 2-(4-fluorophenyl)sulfanyl-1-[(3R)-3-hydroxypyrrolidin-1-yl]-2-phenylethanone |
|---|---|
| PubChem CID | 111561702 |
| Molecular Formula | C18H18FNO2S |
| Molecular Weight | 331.41 g/mol |
| Exact Mass | 331.10 |
| IUPAC Name | 2-(4-fluorophenyl)sulfanyl-1-[(3R)-3-hydroxypyrrolidin-1-yl]-2-phenylethanone |
| SMILES | O=C(C(Sc1ccc(F)cc1)c1ccccc1)N1CC[C@@H](O)C1 |
| InChI | InChI=1S/C18H18FNO2S/c19-14-6-8-16(9-7-14)23-17(13-4-2-1-3-5-13)18(22)20-11-10-15(21)12-20/h1-9,15,17,21H,10-12H2/t15-,17?/m1/s1 |
| InChIKey | SYWDOJGVRXVVBC-LDCVWXEPSA-N |
| XLogP | 3.25 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.41 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |