C17H17NO2S — CID 11822682
(4S,5R)-1-benzyl-4-hydroxy-5-phenylsulfanylpyrrolidin-2-one (PubChem CID 11822682) has the molecular formula C17H17NO2S and a molecular weight of 299.40 g/mol. Its IUPAC name is (4S,5R)-1-benzyl-4-hydroxy-5-phenylsulfanylpyrrolidin-2-one.
| Compound Name | (4S,5R)-1-benzyl-4-hydroxy-5-phenylsulfanylpyrrolidin-2-one |
|---|---|
| PubChem CID | 11822682 |
| Molecular Formula | C17H17NO2S |
| Molecular Weight | 299.40 g/mol |
| Exact Mass | 299.10 |
| IUPAC Name | (4S,5R)-1-benzyl-4-hydroxy-5-phenylsulfanylpyrrolidin-2-one |
| SMILES | O=C1C[C@H](O)[C@@H](Sc2ccccc2)N1Cc1ccccc1 |
| InChI | InChI=1S/C17H17NO2S/c19-15-11-16(20)18(12-13-7-3-1-4-8-13)17(15)21-14-9-5-2-6-10-14/h1-10,15,17,19H,11-12H2/t15-,17+/m0/s1 |
| InChIKey | VTIFHZLTIYTIES-DOTOQJQBSA-N |
| XLogP | 2.90 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.40 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |