C21H25NO2S — CID 24789462
(5S)-5-hydroxy-1-[(2S)-1-phenyl-3-phenylsulfanylpropan-2-yl]azepan-2-one (PubChem CID 24789462) has the molecular formula C21H25NO2S and a molecular weight of 355.50 g/mol. Its IUPAC name is (5S)-5-hydroxy-1-[(2S)-1-phenyl-3-phenylsulfanylpropan-2-yl]azepan-2-one.
| Compound Name | (5S)-5-hydroxy-1-[(2S)-1-phenyl-3-phenylsulfanylpropan-2-yl]azepan-2-one |
|---|---|
| PubChem CID | 24789462 |
| Molecular Formula | C21H25NO2S |
| Molecular Weight | 355.50 g/mol |
| Exact Mass | 355.16 |
| IUPAC Name | (5S)-5-hydroxy-1-[(2S)-1-phenyl-3-phenylsulfanylpropan-2-yl]azepan-2-one |
| SMILES | O=C1CC[C@H](O)CCN1[C@H](CSc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C21H25NO2S/c23-19-11-12-21(24)22(14-13-19)18(15-17-7-3-1-4-8-17)16-25-20-9-5-2-6-10-20/h1-10,18-19,23H,11-16H2/t18-,19-/m0/s1 |
| InChIKey | URELRDUXXJETKY-OALUTQOASA-N |
| XLogP | 3.76 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.50 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |