C22H27NO2S — CID 24816483
(5R)-5-hydroxy-1-[(3S)-3-(4-methylphenyl)sulfanyl-3-phenylpropyl]azepan-2-one (PubChem CID 24816483) has the molecular formula C22H27NO2S and a molecular weight of 369.53 g/mol. Its IUPAC name is (5R)-5-hydroxy-1-[(3S)-3-(4-methylphenyl)sulfanyl-3-phenylpropyl]azepan-2-one.
| Compound Name | (5R)-5-hydroxy-1-[(3S)-3-(4-methylphenyl)sulfanyl-3-phenylpropyl]azepan-2-one |
|---|---|
| PubChem CID | 24816483 |
| Molecular Formula | C22H27NO2S |
| Molecular Weight | 369.53 g/mol |
| Exact Mass | 369.18 |
| IUPAC Name | (5R)-5-hydroxy-1-[(3S)-3-(4-methylphenyl)sulfanyl-3-phenylpropyl]azepan-2-one |
| SMILES | Cc1ccc(S[C@@H](CCN2CC[C@H](O)CCC2=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C22H27NO2S/c1-17-7-10-20(11-8-17)26-21(18-5-3-2-4-6-18)14-16-23-15-13-19(24)9-12-22(23)25/h2-8,10-11,19,21,24H,9,12-16H2,1H3/t19-,21+/m1/s1 |
| InChIKey | OPIGOEJBYIJNAW-CTNGQTDRSA-N |
| XLogP | 4.59 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.53 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |