C23H25NO2S2Se — CID 102273505
(E,2R,3S)-3-hydroxy-2-phenylselanyl-1-[(4R)-4-phenyl-2-sulfanylidene-1,3-thiazolidin-3-yl]oct-4-en-1-one (PubChem CID 102273505) has the molecular formula C23H25NO2S2Se and a molecular weight of 490.55 g/mol. Its IUPAC name is (E,2R,3S)-3-hydroxy-2-phenylselanyl-1-[(4R)-4-phenyl-2-sulfanylidene-1,3-thiazolidin-3-yl]oct-4-en-1-one.
| Compound Name | (E,2R,3S)-3-hydroxy-2-phenylselanyl-1-[(4R)-4-phenyl-2-sulfanylidene-1,3-thiazolidin-3-yl]oct-4-en-1-one |
|---|---|
| PubChem CID | 102273505 |
| Molecular Formula | C23H25NO2S2Se |
| Molecular Weight | 490.55 g/mol |
| Exact Mass | 491.05 |
| IUPAC Name | (E,2R,3S)-3-hydroxy-2-phenylselanyl-1-[(4R)-4-phenyl-2-sulfanylidene-1,3-thiazolidin-3-yl]oct-4-en-1-one |
| SMILES | CCC/C=C/[C@H](O)[C@@H]([Se]c1ccccc1)C(=O)N1C(=S)SC[C@H]1c1ccccc1 |
| InChI | InChI=1S/C23H25NO2S2Se/c1-2-3-6-15-20(25)21(29-18-13-9-5-10-14-18)22(26)24-19(16-28-23(24)27)17-11-7-4-8-12-17/h4-15,19-21,25H,2-3,16H2,1H3/b15-6+/t19-,20-,21+/m0/s1 |
| InChIKey | MOOIZOCTPFWARJ-QXDJYPIOSA-N |
| XLogP | 4.12 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.55 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|