C33H51IN4O6S2 — CID 142390066
5-[2-[3-[(3,3-dimethyl-1-oxobutan-2-yl)amino]-3-oxopropoxy]ethoxy]pentoxy thiohypoiodite;1-methyl-N-[[4-(4-methyl-1,3-thiazol-5-yl)phenyl]methyl]pyrrolidine-2-carboxamide (PubChem CID 142390066) has the molecular formula C33H51IN4O6S2 and a molecular weight of 790.83 g/mol. Its IUPAC name is 5-[2-[3-[(3,3-dimethyl-1-oxobutan-2-yl)amino]-3-oxopropoxy]ethoxy]pentoxy thiohypoiodite;1-methyl-N-[[4-(4-methyl-1,3-thiazol-5-yl)phenyl]methyl]pyrrolidine-2-carboxamide.
| Compound Name | 5-[2-[3-[(3,3-dimethyl-1-oxobutan-2-yl)amino]-3-oxopropoxy]ethoxy]pentoxy thiohypoiodite;1-methyl-N-[[4-(4-methyl-1,3-thiazol-5-yl)phenyl]methyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 142390066 |
| Molecular Formula | C33H51IN4O6S2 |
| Molecular Weight | 790.83 g/mol |
| Exact Mass | 790.23 |
| IUPAC Name | 5-[2-[3-[(3,3-dimethyl-1-oxobutan-2-yl)amino]-3-oxopropoxy]ethoxy]pentoxy thiohypoiodite;1-methyl-N-[[4-(4-methyl-1,3-thiazol-5-yl)phenyl]methyl]pyrrolidine-2-carboxamide |
| SMILES | CC(C)(C)C(C=O)NC(=O)CCOCCOCCCCCOSI.Cc1ncsc1-c1ccc(CNC(=O)C2CCCN2C)cc1 |
| InChI | InChI=1S/C17H21N3OS.C16H30INO5S/c1-12-16(22-11-19-12)14-7-5-13(6-8-14)10-18-17(21)15-4-3-9-20(15)2;1-16(2,3)14(13-19)18-15(20)7-10-22-12-11-21-8-5-4-6-9-23-24-17/h5-8,11,15H,3-4,9-10H2,1-2H3,(H,18,21);13-14H,4-12H2,1-3H3,(H,18,20) |
| InChIKey | MKJNOOJMHUPSKJ-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 119.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 790.83 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|