C23H35N3O3S — CID 177181837
methanol;1-methyl-N-[[4-(4-methyl-1,3-thiazol-5-yl)phenyl]methyl]pyrrolidine-2-carboxamide;pentanal (PubChem CID 177181837) has the molecular formula C23H35N3O3S and a molecular weight of 433.62 g/mol. Its IUPAC name is methanol;1-methyl-N-[[4-(4-methyl-1,3-thiazol-5-yl)phenyl]methyl]pyrrolidine-2-carboxamide;pentanal.
| Compound Name | methanol;1-methyl-N-[[4-(4-methyl-1,3-thiazol-5-yl)phenyl]methyl]pyrrolidine-2-carboxamide;pentanal |
|---|---|
| PubChem CID | 177181837 |
| Molecular Formula | C23H35N3O3S |
| Molecular Weight | 433.62 g/mol |
| Exact Mass | 433.24 |
| IUPAC Name | methanol;1-methyl-N-[[4-(4-methyl-1,3-thiazol-5-yl)phenyl]methyl]pyrrolidine-2-carboxamide;pentanal |
| SMILES | CCCCC=O.CO.Cc1ncsc1-c1ccc(CNC(=O)C2CCCN2C)cc1 |
| InChI | InChI=1S/C17H21N3OS.C5H10O.CH4O/c1-12-16(22-11-19-12)14-7-5-13(6-8-14)10-18-17(21)15-4-3-9-20(15)2;1-2-3-4-5-6;1-2/h5-8,11,15H,3-4,9-10H2,1-2H3,(H,18,21);5H,2-4H2,1H3;2H,1H3 |
| InChIKey | AEGCVFYHVFCZHF-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 82.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.62 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|