C19H40N4 — CID 142390553
ethane;(2Z,4E)-2-[3-(4-methylpiperazin-1-yl)propyliminomethyl]hexa-2,4-dien-1-amine (PubChem CID 142390553) has the molecular formula C19H40N4 and a molecular weight of 324.56 g/mol. Its IUPAC name is ethane;(2Z,4E)-2-[3-(4-methylpiperazin-1-yl)propyliminomethyl]hexa-2,4-dien-1-amine.
| Compound Name | ethane;(2Z,4E)-2-[3-(4-methylpiperazin-1-yl)propyliminomethyl]hexa-2,4-dien-1-amine |
|---|---|
| PubChem CID | 142390553 |
| Molecular Formula | C19H40N4 |
| Molecular Weight | 324.56 g/mol |
| Exact Mass | 324.33 |
| IUPAC Name | ethane;(2Z,4E)-2-[3-(4-methylpiperazin-1-yl)propyliminomethyl]hexa-2,4-dien-1-amine |
| SMILES | C/C=C/C=C(\C=N\CCCN1CCN(C)CC1)CN.CC.CC |
| InChI | InChI=1S/C15H28N4.2C2H6/c1-3-4-6-15(13-16)14-17-7-5-8-19-11-9-18(2)10-12-19;2*1-2/h3-4,6,14H,5,7-13,16H2,1-2H3;2*1-2H3/b4-3+,15-6-,17-14+;; |
| InChIKey | UGNDYLVTXAGMAL-BQIIHBBYSA-N |
| XLogP | 3.21 |
| TPSA | 44.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.56 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|