About 1-ethyl-4-hexylpiperazine;N-methylformamide
1-ethyl-4-hexylpiperazine;N-methylformamide (PubChem CID 142390895) has the molecular formula C14H31N3O
and a molecular weight of 257.42 g/mol. Its IUPAC name is 1-ethyl-4-hexylpiperazine;N-methylformamide.
Molecular Properties
| Compound Name | 1-ethyl-4-hexylpiperazine;N-methylformamide |
| PubChem CID | 142390895 |
| Molecular Formula | C14H31N3O |
| Molecular Weight | 257.42 g/mol |
| Exact Mass | 257.25 |
| IUPAC Name | 1-ethyl-4-hexylpiperazine;N-methylformamide |
| SMILES | CCCCCCN1CCN(CC)CC1.CNC=O |
| InChI | InChI=1S/C12H26N2.C2H5NO/c1-3-5-6-7-8-14-11-9-13(4-2)10-12-14;1-3-2-4/h3-12H2,1-2H3;2H,1H3,(H,3,4) |
| InChIKey | ITBZROSFXVHAKI-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.42 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-ethyl-4-hexylpiperazine;N-methylformamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethyl-4-hexylpiperazine;N-methylformamide?
The IUPAC name of 1-ethyl-4-hexylpiperazine;N-methylformamide (CID 142390895) is 1-ethyl-4-hexylpiperazine;N-methylformamide.
What is the SMILES notation for 1-ethyl-4-hexylpiperazine;N-methylformamide?
The canonical SMILES for 1-ethyl-4-hexylpiperazine;N-methylformamide is CCCCCCN1CCN(CC)CC1.CNC=O.
What is the InChIKey of 1-ethyl-4-hexylpiperazine;N-methylformamide?
The InChIKey is ITBZROSFXVHAKI-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H26N2.C2H5NO/c1-3-5-6-7-8-14-11-9-13(4-2)10-12-14;1-3-2-4/h3-12H2,1-2H3;2H,1H3,(H,3,4).
What are the key properties of 1-ethyl-4-hexylpiperazine;N-methylformamide?
1-ethyl-4-hexylpiperazine;N-methylformamide has a molecular weight of 257.42 g/mol, XLogP of 1.57, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethyl-4-hexylpiperazine;N-methylformamide is sourced from PubChem (CID 142390895), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).