C20H19F2N5O2 — CID 142392299
5-[2-(2,6-difluoro-3,5-dimethoxyphenyl)ethynyl]-7-pyrrolidin-3-ylpyrrolo[2,1-f][1,2,4]triazin-4-amine (PubChem CID 142392299) has the molecular formula C20H19F2N5O2 and a molecular weight of 399.40 g/mol. Its IUPAC name is 5-[2-(2,6-difluoro-3,5-dimethoxyphenyl)ethynyl]-7-pyrrolidin-3-ylpyrrolo[2,1-f][1,2,4]triazin-4-amine.
| Compound Name | 5-[2-(2,6-difluoro-3,5-dimethoxyphenyl)ethynyl]-7-pyrrolidin-3-ylpyrrolo[2,1-f][1,2,4]triazin-4-amine |
|---|---|
| PubChem CID | 142392299 |
| Molecular Formula | C20H19F2N5O2 |
| Molecular Weight | 399.40 g/mol |
| Exact Mass | 399.15 |
| IUPAC Name | 5-[2-(2,6-difluoro-3,5-dimethoxyphenyl)ethynyl]-7-pyrrolidin-3-ylpyrrolo[2,1-f][1,2,4]triazin-4-amine |
| SMILES | COc1cc(OC)c(F)c(C#Cc2cc(C3CCNC3)n3ncnc(N)c23)c1F |
| InChI | InChI=1S/C20H19F2N5O2/c1-28-15-8-16(29-2)18(22)13(17(15)21)4-3-11-7-14(12-5-6-24-9-12)27-19(11)20(23)25-10-26-27/h7-8,10,12,24H,5-6,9H2,1-2H3,(H2,23,25,26) |
| InChIKey | JYPZJFZGZYUBKH-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 86.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.40 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|