C23H24N2O4 — CID 142394247
[4-[(E)-[(E)-(4-methoxyphenyl)methylidenehydrazinylidene]methyl]phenyl] 2-methylprop-2-enoate;2-methylprop-2-enal (PubChem CID 142394247) has the molecular formula C23H24N2O4 and a molecular weight of 392.46 g/mol. Its IUPAC name is [4-[(E)-[(E)-(4-methoxyphenyl)methylidenehydrazinylidene]methyl]phenyl] 2-methylprop-2-enoate;2-methylprop-2-enal.
| Compound Name | [4-[(E)-[(E)-(4-methoxyphenyl)methylidenehydrazinylidene]methyl]phenyl] 2-methylprop-2-enoate;2-methylprop-2-enal |
|---|---|
| PubChem CID | 142394247 |
| Molecular Formula | C23H24N2O4 |
| Molecular Weight | 392.46 g/mol |
| Exact Mass | 392.17 |
| IUPAC Name | [4-[(E)-[(E)-(4-methoxyphenyl)methylidenehydrazinylidene]methyl]phenyl] 2-methylprop-2-enoate;2-methylprop-2-enal |
| SMILES | C=C(C)C(=O)Oc1ccc(/C=N/N=C/c2ccc(OC)cc2)cc1.C=C(C)C=O |
| InChI | InChI=1S/C19H18N2O3.C4H6O/c1-14(2)19(22)24-18-10-6-16(7-11-18)13-21-20-12-15-4-8-17(23-3)9-5-15;1-4(2)3-5/h4-13H,1H2,2-3H3;3H,1H2,2H3/b20-12+,21-13+; |
| InChIKey | QNGJCLOAGATGIY-DDVVPQEFSA-N |
| XLogP | 4.39 |
| TPSA | 77.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.46 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|