C17H18BrNS — CID 142394292
2-[(1E,7Z)-5-bromocycloocta-1,4,7-trien-1-yl]-4,7-dimethyl-5,6-dihydro-1,3-benzothiazole (PubChem CID 142394292) has the molecular formula C17H18BrNS and a molecular weight of 348.31 g/mol. Its IUPAC name is 2-[(1E,7Z)-5-bromocycloocta-1,4,7-trien-1-yl]-4,7-dimethyl-5,6-dihydro-1,3-benzothiazole.
| Compound Name | 2-[(1E,7Z)-5-bromocycloocta-1,4,7-trien-1-yl]-4,7-dimethyl-5,6-dihydro-1,3-benzothiazole |
|---|---|
| PubChem CID | 142394292 |
| Molecular Formula | C17H18BrNS |
| Molecular Weight | 348.31 g/mol |
| Exact Mass | 347.03 |
| IUPAC Name | 2-[(1E,7Z)-5-bromocycloocta-1,4,7-trien-1-yl]-4,7-dimethyl-5,6-dihydro-1,3-benzothiazole |
| SMILES | CC1=c2nc(C3=C/CC=C(Br)C/C=C\3)sc2=C(C)CC1 |
| InChI | InChI=1S/C17H18BrNS/c1-11-9-10-12(2)16-15(11)19-17(20-16)13-5-3-7-14(18)8-4-6-13/h3,5-6,8H,4,7,9-10H2,1-2H3/b5-3-,13-6+,14-8? |
| InChIKey | OTKZFGUPFLEGBC-AGMDBBEZSA-N |
| XLogP | 4.29 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.31 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |