C19H25NS — CID 142358276
4,7-dimethyl-2-[(3E,5Z)-8-methylnona-1,3,5-trien-4-yl]-5,6-dihydro-1,3-benzothiazole (PubChem CID 142358276) has the molecular formula C19H25NS and a molecular weight of 299.48 g/mol. Its IUPAC name is 4,7-dimethyl-2-[(3E,5Z)-8-methylnona-1,3,5-trien-4-yl]-5,6-dihydro-1,3-benzothiazole.
| Compound Name | 4,7-dimethyl-2-[(3E,5Z)-8-methylnona-1,3,5-trien-4-yl]-5,6-dihydro-1,3-benzothiazole |
|---|---|
| PubChem CID | 142358276 |
| Molecular Formula | C19H25NS |
| Molecular Weight | 299.48 g/mol |
| Exact Mass | 299.17 |
| IUPAC Name | 4,7-dimethyl-2-[(3E,5Z)-8-methylnona-1,3,5-trien-4-yl]-5,6-dihydro-1,3-benzothiazole |
| SMILES | C=C/C=C(\C=C/CC(C)C)c1nc2c(s1)=C(C)CCC=2C |
| InChI | InChI=1S/C19H25NS/c1-6-8-16(10-7-9-13(2)3)19-20-17-14(4)11-12-15(5)18(17)21-19/h6-8,10,13H,1,9,11-12H2,2-5H3/b10-7-,16-8+ |
| InChIKey | LYVBTUILUZVXHL-AREXIAQWSA-N |
| XLogP | 4.45 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.48 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|