C23H35NS — CID 144513129
ethane;(4E)-5-methylidene-2-[(3E,5Z)-5-methylocta-1,3,5,7-tetraen-4-yl]-4-[(Z)-3-methylpent-3-enylidene]-1,3-thiazole (PubChem CID 144513129) has the molecular formula C23H35NS and a molecular weight of 357.61 g/mol. Its IUPAC name is ethane;(4E)-5-methylidene-2-[(3E,5Z)-5-methylocta-1,3,5,7-tetraen-4-yl]-4-[(Z)-3-methylpent-3-enylidene]-1,3-thiazole.
| Compound Name | ethane;(4E)-5-methylidene-2-[(3E,5Z)-5-methylocta-1,3,5,7-tetraen-4-yl]-4-[(Z)-3-methylpent-3-enylidene]-1,3-thiazole |
|---|---|
| PubChem CID | 144513129 |
| Molecular Formula | C23H35NS |
| Molecular Weight | 357.61 g/mol |
| Exact Mass | 357.25 |
| IUPAC Name | ethane;(4E)-5-methylidene-2-[(3E,5Z)-5-methylocta-1,3,5,7-tetraen-4-yl]-4-[(Z)-3-methylpent-3-enylidene]-1,3-thiazole |
| SMILES | C=C/C=C(C)\C(=C/C=C)c1n/c(=C/C/C(C)=C\C)c(=C)s1.CC.CC |
| InChI | InChI=1S/C19H23NS.2C2H6/c1-7-10-15(5)17(11-8-2)19-20-18(16(6)21-19)13-12-14(4)9-3;2*1-2/h7-11,13H,1-2,6,12H2,3-5H3;2*1-2H3/b14-9-,15-10-,17-11+,18-13+;; |
| InChIKey | BSAMOWHNZKDCBZ-JFYHRRDQSA-N |
| XLogP | 6.44 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.61 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|