C18H21NS — CID 142044075
methyl (2E,3Z)-N-[(3E,5Z)-octa-1,3,5,7-tetraen-4-yl]-2-prop-2-enylidenehexa-3,5-dienimidothioate (PubChem CID 142044075) has the molecular formula C18H21NS and a molecular weight of 283.44 g/mol. Its IUPAC name is methyl (2E,3Z)-N-[(3E,5Z)-octa-1,3,5,7-tetraen-4-yl]-2-prop-2-enylidenehexa-3,5-dienimidothioate.
| Compound Name | methyl (2E,3Z)-N-[(3E,5Z)-octa-1,3,5,7-tetraen-4-yl]-2-prop-2-enylidenehexa-3,5-dienimidothioate |
|---|---|
| PubChem CID | 142044075 |
| Molecular Formula | C18H21NS |
| Molecular Weight | 283.44 g/mol |
| Exact Mass | 283.14 |
| IUPAC Name | methyl (2E,3Z)-N-[(3E,5Z)-octa-1,3,5,7-tetraen-4-yl]-2-prop-2-enylidenehexa-3,5-dienimidothioate |
| SMILES | C=C/C=C\C(=C/C=C)\N=C(SC)/C(/C=C\C=C)=C/C=C |
| InChI | InChI=1S/C18H21NS/c1-6-10-14-16(12-8-3)18(20-5)19-17(13-9-4)15-11-7-2/h6-15H,1-4H2,5H3/b14-10-,15-11-,16-12+,17-13+,19-18- |
| InChIKey | RWBREGYPNXWIKS-JTJPWQMMSA-N |
| XLogP | 5.41 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.44 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|