C19H23NS — CID 144513130
(4E)-5-methylidene-2-[(3E,5Z)-5-methylocta-1,3,5,7-tetraen-4-yl]-4-[(Z)-3-methylpent-3-enylidene]-1,3-thiazole (PubChem CID 144513130) has the molecular formula C19H23NS and a molecular weight of 297.47 g/mol. Its IUPAC name is (4E)-5-methylidene-2-[(3E,5Z)-5-methylocta-1,3,5,7-tetraen-4-yl]-4-[(Z)-3-methylpent-3-enylidene]-1,3-thiazole.
| Compound Name | (4E)-5-methylidene-2-[(3E,5Z)-5-methylocta-1,3,5,7-tetraen-4-yl]-4-[(Z)-3-methylpent-3-enylidene]-1,3-thiazole |
|---|---|
| PubChem CID | 144513130 |
| Molecular Formula | C19H23NS |
| Molecular Weight | 297.47 g/mol |
| Exact Mass | 297.16 |
| IUPAC Name | (4E)-5-methylidene-2-[(3E,5Z)-5-methylocta-1,3,5,7-tetraen-4-yl]-4-[(Z)-3-methylpent-3-enylidene]-1,3-thiazole |
| SMILES | C=C/C=C(C)\C(=C/C=C)c1n/c(=C/C/C(C)=C\C)c(=C)s1 |
| InChI | InChI=1S/C19H23NS/c1-7-10-15(5)17(11-8-2)19-20-18(16(6)21-19)13-12-14(4)9-3/h7-11,13H,1-2,6,12H2,3-5H3/b14-9-,15-10-,17-11+,18-13+ |
| InChIKey | HNVKCIOCNIDKFQ-UPIAUTTDSA-N |
| XLogP | 4.39 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.47 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|