C20H28N2S — CID 142394294
5-(4,7-dimethyl-5,6-dihydro-1,3-benzothiazol-2-yl)-N,N-dimethylcyclohepta-1,4,6-trien-1-amine;ethane (PubChem CID 142394294) has the molecular formula C20H28N2S and a molecular weight of 328.53 g/mol. Its IUPAC name is 5-(4,7-dimethyl-5,6-dihydro-1,3-benzothiazol-2-yl)-N,N-dimethylcyclohepta-1,4,6-trien-1-amine;ethane.
| Compound Name | 5-(4,7-dimethyl-5,6-dihydro-1,3-benzothiazol-2-yl)-N,N-dimethylcyclohepta-1,4,6-trien-1-amine;ethane |
|---|---|
| PubChem CID | 142394294 |
| Molecular Formula | C20H28N2S |
| Molecular Weight | 328.53 g/mol |
| Exact Mass | 328.20 |
| IUPAC Name | 5-(4,7-dimethyl-5,6-dihydro-1,3-benzothiazol-2-yl)-N,N-dimethylcyclohepta-1,4,6-trien-1-amine;ethane |
| SMILES | CC.CC1=c2nc(C3=CCC=C(N(C)C)C=C3)sc2=C(C)CC1 |
| InChI | InChI=1S/C18H22N2S.C2H6/c1-12-8-9-13(2)17-16(12)19-18(21-17)14-6-5-7-15(11-10-14)20(3)4;1-2/h6-7,10-11H,5,8-9H2,1-4H3;1-2H3 |
| InChIKey | GWALTRQZNQAORF-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.53 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |