C17H19Cl2NS — CID 143946305
methyl N-(5-chlorocyclohepta-1,2,4,6-tetraen-1-yl)-2-(1-chloroethenyl)-3-ethylpent-2-enimidothioate (PubChem CID 143946305) has the molecular formula C17H19Cl2NS and a molecular weight of 340.32 g/mol. Its IUPAC name is methyl N-(5-chlorocyclohepta-1,2,4,6-tetraen-1-yl)-2-(1-chloroethenyl)-3-ethylpent-2-enimidothioate.
| Compound Name | methyl N-(5-chlorocyclohepta-1,2,4,6-tetraen-1-yl)-2-(1-chloroethenyl)-3-ethylpent-2-enimidothioate |
|---|---|
| PubChem CID | 143946305 |
| Molecular Formula | C17H19Cl2NS |
| Molecular Weight | 340.32 g/mol |
| Exact Mass | 339.06 |
| IUPAC Name | methyl N-(5-chlorocyclohepta-1,2,4,6-tetraen-1-yl)-2-(1-chloroethenyl)-3-ethylpent-2-enimidothioate |
| SMILES | C=C(Cl)C(=C(CC)CC)/C(=N/C1=C=CC=C(Cl)C=C1)SC |
| InChI | InChI=1S/C17H19Cl2NS/c1-5-13(6-2)16(12(3)18)17(21-4)20-15-9-7-8-14(19)10-11-15/h7-8,10-11H,3,5-6H2,1-2,4H3/b20-17- |
| InChIKey | YGZDNADIQJURHW-JZJYNLBNSA-N |
| XLogP | 6.35 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.32 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|