C31H33NS — CID 134313631
(3E,5Z)-N-[(1E)-1-[(2E)-4-[(1Z)-buta-1,3-dienyl]-5-ethenyl-2-prop-2-enylidenethiophen-3-ylidene]prop-2-enyl]-N-[(3E,5Z)-hepta-1,3,5-trien-4-yl]octa-1,3,5,7-tetraen-4-amine (PubChem CID 134313631) has the molecular formula C31H33NS and a molecular weight of 451.68 g/mol. Its IUPAC name is (3E,5Z)-N-[(1E)-1-[(2E)-4-[(1Z)-buta-1,3-dienyl]-5-ethenyl-2-prop-2-enylidenethiophen-3-ylidene]prop-2-enyl]-N-[(3E,5Z)-hepta-1,3,5-trien-4-yl]octa-1,3,5,7-tetraen-4-amine.
| Compound Name | (3E,5Z)-N-[(1E)-1-[(2E)-4-[(1Z)-buta-1,3-dienyl]-5-ethenyl-2-prop-2-enylidenethiophen-3-ylidene]prop-2-enyl]-N-[(3E,5Z)-hepta-1,3,5-trien-4-yl]octa-1,3,5,7-tetraen-4-amine |
|---|---|
| PubChem CID | 134313631 |
| Molecular Formula | C31H33NS |
| Molecular Weight | 451.68 g/mol |
| Exact Mass | 451.23 |
| IUPAC Name | (3E,5Z)-N-[(1E)-1-[(2E)-4-[(1Z)-buta-1,3-dienyl]-5-ethenyl-2-prop-2-enylidenethiophen-3-ylidene]prop-2-enyl]-N-[(3E,5Z)-hepta-1,3,5-trien-4-yl]octa-1,3,5,7-tetraen-4-amine |
| SMILES | C=C/C=C\C(=C/C=C)N(C(/C=C\C)=C/C=C)/C(C=C)=c1\c(/C=C\C=C)c(C=C)s\c1=C\C=C |
| InChI | InChI=1S/C31H33NS/c1-9-17-23-26(21-13-5)32(25(19-11-3)20-12-4)28(15-7)31-27(24-18-10-2)29(16-8)33-30(31)22-14-6/h9-24H,1-3,5-8H2,4H3/b20-12-,23-17-,24-18-,25-19+,26-21+,30-22+,31-28+ |
| InChIKey | DPJJPVWUEKLIGI-SXLNDLOCSA-N |
| XLogP | 7.61 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.68 |
| LogP ≤ 5 | 7.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|