C22H32O4 — CID 142394348
bis(3-methylbut-3-enyl) tricyclo[5.2.1.02,6]decane-1,2-dicarboxylate (PubChem CID 142394348) has the molecular formula C22H32O4 and a molecular weight of 360.49 g/mol. Its IUPAC name is bis(3-methylbut-3-enyl) tricyclo[5.2.1.02,6]decane-1,2-dicarboxylate.
| Compound Name | bis(3-methylbut-3-enyl) tricyclo[5.2.1.02,6]decane-1,2-dicarboxylate |
|---|---|
| PubChem CID | 142394348 |
| Molecular Formula | C22H32O4 |
| Molecular Weight | 360.49 g/mol |
| Exact Mass | 360.23 |
| IUPAC Name | bis(3-methylbut-3-enyl) tricyclo[5.2.1.02,6]decane-1,2-dicarboxylate |
| SMILES | C=C(C)CCOC(=O)C12CCC(C1)C1CCCC12C(=O)OCCC(=C)C |
| InChI | InChI=1S/C22H32O4/c1-15(2)8-12-25-19(23)21-11-7-17(14-21)18-6-5-10-22(18,21)20(24)26-13-9-16(3)4/h17-18H,1,3,5-14H2,2,4H3 |
| InChIKey | CGMIHKLBFUYMML-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.49 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|