C21H23ClN2O3 — CID 142395284
5-[(2-chlorophenyl)methyl]-4-[(2E)-2-ethenylpenta-2,4-dienoxy]-2,6-dimethylpyrimidine;formic acid (PubChem CID 142395284) has the molecular formula C21H23ClN2O3 and a molecular weight of 386.88 g/mol. Its IUPAC name is 5-[(2-chlorophenyl)methyl]-4-[(2E)-2-ethenylpenta-2,4-dienoxy]-2,6-dimethylpyrimidine;formic acid.
| Compound Name | 5-[(2-chlorophenyl)methyl]-4-[(2E)-2-ethenylpenta-2,4-dienoxy]-2,6-dimethylpyrimidine;formic acid |
|---|---|
| PubChem CID | 142395284 |
| Molecular Formula | C21H23ClN2O3 |
| Molecular Weight | 386.88 g/mol |
| Exact Mass | 386.14 |
| IUPAC Name | 5-[(2-chlorophenyl)methyl]-4-[(2E)-2-ethenylpenta-2,4-dienoxy]-2,6-dimethylpyrimidine;formic acid |
| SMILES | C=C/C=C(\C=C)COc1nc(C)nc(C)c1Cc1ccccc1Cl.O=CO |
| InChI | InChI=1S/C20H21ClN2O.CH2O2/c1-5-9-16(6-2)13-24-20-18(14(3)22-15(4)23-20)12-17-10-7-8-11-19(17)21;2-1-3/h5-11H,1-2,12-13H2,3-4H3;1H,(H,2,3)/b16-9+; |
| InChIKey | YIJNHKCXZBKDDI-QOVZSLTQSA-N |
| XLogP | 4.72 |
| TPSA | 72.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.88 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|