C20H28O4 — CID 14239543
[(6S,8aR)-6,8a-dimethyl-2,7-dioxo-3-propan-2-yl-1,4,5,8-tetrahydroazulen-6-yl] (Z)-2-methylbut-2-enoate (PubChem CID 14239543) has the molecular formula C20H28O4 and a molecular weight of 332.44 g/mol. Its IUPAC name is [(6S,8aR)-6,8a-dimethyl-2,7-dioxo-3-propan-2-yl-1,4,5,8-tetrahydroazulen-6-yl] (Z)-2-methylbut-2-enoate.
| Compound Name | [(6S,8aR)-6,8a-dimethyl-2,7-dioxo-3-propan-2-yl-1,4,5,8-tetrahydroazulen-6-yl] (Z)-2-methylbut-2-enoate |
|---|---|
| PubChem CID | 14239543 |
| Molecular Formula | C20H28O4 |
| Molecular Weight | 332.44 g/mol |
| Exact Mass | 332.20 |
| IUPAC Name | [(6S,8aR)-6,8a-dimethyl-2,7-dioxo-3-propan-2-yl-1,4,5,8-tetrahydroazulen-6-yl] (Z)-2-methylbut-2-enoate |
| SMILES | C/C=C(/C)C(=O)O[C@@]1(C)CCC2=C(C(C)C)C(=O)C[C@]2(C)CC1=O |
| InChI | InChI=1S/C20H28O4/c1-7-13(4)18(23)24-20(6)9-8-14-17(12(2)3)15(21)10-19(14,5)11-16(20)22/h7,12H,8-11H2,1-6H3/b13-7-/t19-,20+/m1/s1 |
| InChIKey | OSTXIULWNKQJTL-XTLGIRLXSA-N |
| XLogP | 3.94 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.44 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|