C21H21F3N4O6S2 — CID 142395884
tert-butyl 3-[7-(1,3-thiazol-2-yl)-5-(trifluoromethylsulfonyloxy)-1,3-benzoxazol-2-yl]-3,6-diazabicyclo[3.1.1]heptane-6-carboxylate (PubChem CID 142395884) has the molecular formula C21H21F3N4O6S2 and a molecular weight of 546.55 g/mol. Its IUPAC name is tert-butyl 3-[7-(1,3-thiazol-2-yl)-5-(trifluoromethylsulfonyloxy)-1,3-benzoxazol-2-yl]-3,6-diazabicyclo[3.1.1]heptane-6-carboxylate.
| Compound Name | tert-butyl 3-[7-(1,3-thiazol-2-yl)-5-(trifluoromethylsulfonyloxy)-1,3-benzoxazol-2-yl]-3,6-diazabicyclo[3.1.1]heptane-6-carboxylate |
|---|---|
| PubChem CID | 142395884 |
| Molecular Formula | C21H21F3N4O6S2 |
| Molecular Weight | 546.55 g/mol |
| Exact Mass | 546.09 |
| IUPAC Name | tert-butyl 3-[7-(1,3-thiazol-2-yl)-5-(trifluoromethylsulfonyloxy)-1,3-benzoxazol-2-yl]-3,6-diazabicyclo[3.1.1]heptane-6-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C2CC1CN(c1nc3cc(OS(=O)(=O)C(F)(F)F)cc(-c4nccs4)c3o1)C2 |
| InChI | InChI=1S/C21H21F3N4O6S2/c1-20(2,3)33-19(29)28-11-6-12(28)10-27(9-11)18-26-15-8-13(34-36(30,31)21(22,23)24)7-14(16(15)32-18)17-25-4-5-35-17/h4-5,7-8,11-12H,6,9-10H2,1-3H3 |
| InChIKey | XDALOCPNLVXTBO-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 115.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.55 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|