C24H24F3N5O4S — CID 142396047
tert-butyl 3-[5-[1-(cyanomethoxy)-2,2,2-trifluoroethyl]-7-(1,3-thiazol-2-yl)-1,3-benzoxazol-2-yl]-3,6-diazabicyclo[3.1.1]heptane-6-carboxylate (PubChem CID 142396047) has the molecular formula C24H24F3N5O4S and a molecular weight of 535.55 g/mol. Its IUPAC name is tert-butyl 3-[5-[1-(cyanomethoxy)-2,2,2-trifluoroethyl]-7-(1,3-thiazol-2-yl)-1,3-benzoxazol-2-yl]-3,6-diazabicyclo[3.1.1]heptane-6-carboxylate.
| Compound Name | tert-butyl 3-[5-[1-(cyanomethoxy)-2,2,2-trifluoroethyl]-7-(1,3-thiazol-2-yl)-1,3-benzoxazol-2-yl]-3,6-diazabicyclo[3.1.1]heptane-6-carboxylate |
|---|---|
| PubChem CID | 142396047 |
| Molecular Formula | C24H24F3N5O4S |
| Molecular Weight | 535.55 g/mol |
| Exact Mass | 535.15 |
| IUPAC Name | tert-butyl 3-[5-[1-(cyanomethoxy)-2,2,2-trifluoroethyl]-7-(1,3-thiazol-2-yl)-1,3-benzoxazol-2-yl]-3,6-diazabicyclo[3.1.1]heptane-6-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C2CC1CN(c1nc3cc(C(OCC#N)C(F)(F)F)cc(-c4nccs4)c3o1)C2 |
| InChI | InChI=1S/C24H24F3N5O4S/c1-23(2,3)36-22(33)32-14-10-15(32)12-31(11-14)21-30-17-9-13(19(24(25,26)27)34-6-4-28)8-16(18(17)35-21)20-29-5-7-37-20/h5,7-9,14-15,19H,6,10-12H2,1-3H3 |
| InChIKey | OCWWRCCRLISVBA-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 104.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.55 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |