C22H23F3N4O5S — CID 142396269
tert-butyl 3-[7-(1,3-thiazol-2-yl)-4-(2,2,2-trifluoro-1,1-dihydroxyethyl)-1,3-benzoxazol-2-yl]-3,6-diazabicyclo[3.1.1]heptane-6-carboxylate (PubChem CID 142396269) has the molecular formula C22H23F3N4O5S and a molecular weight of 512.51 g/mol. Its IUPAC name is tert-butyl 3-[7-(1,3-thiazol-2-yl)-4-(2,2,2-trifluoro-1,1-dihydroxyethyl)-1,3-benzoxazol-2-yl]-3,6-diazabicyclo[3.1.1]heptane-6-carboxylate.
| Compound Name | tert-butyl 3-[7-(1,3-thiazol-2-yl)-4-(2,2,2-trifluoro-1,1-dihydroxyethyl)-1,3-benzoxazol-2-yl]-3,6-diazabicyclo[3.1.1]heptane-6-carboxylate |
|---|---|
| PubChem CID | 142396269 |
| Molecular Formula | C22H23F3N4O5S |
| Molecular Weight | 512.51 g/mol |
| Exact Mass | 512.13 |
| IUPAC Name | tert-butyl 3-[7-(1,3-thiazol-2-yl)-4-(2,2,2-trifluoro-1,1-dihydroxyethyl)-1,3-benzoxazol-2-yl]-3,6-diazabicyclo[3.1.1]heptane-6-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C2CC1CN(c1nc3c(C(O)(O)C(F)(F)F)ccc(-c4nccs4)c3o1)C2 |
| InChI | InChI=1S/C22H23F3N4O5S/c1-20(2,3)34-19(30)29-11-8-12(29)10-28(9-11)18-27-15-14(21(31,32)22(23,24)25)5-4-13(16(15)33-18)17-26-6-7-35-17/h4-7,11-12,31-32H,8-10H2,1-3H3 |
| InChIKey | MFCBHWPDMRGSLN-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 112.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.51 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|