C23H26F2N4O6S — CID 142396544
tert-butyl 3-[4-(1,1-difluoro-2,2-dihydroxypropoxy)-7-(1,3-thiazol-2-yl)-1,3-benzoxazol-2-yl]-3,6-diazabicyclo[3.1.1]heptane-6-carboxylate (PubChem CID 142396544) has the molecular formula C23H26F2N4O6S and a molecular weight of 524.55 g/mol. Its IUPAC name is tert-butyl 3-[4-(1,1-difluoro-2,2-dihydroxypropoxy)-7-(1,3-thiazol-2-yl)-1,3-benzoxazol-2-yl]-3,6-diazabicyclo[3.1.1]heptane-6-carboxylate.
| Compound Name | tert-butyl 3-[4-(1,1-difluoro-2,2-dihydroxypropoxy)-7-(1,3-thiazol-2-yl)-1,3-benzoxazol-2-yl]-3,6-diazabicyclo[3.1.1]heptane-6-carboxylate |
|---|---|
| PubChem CID | 142396544 |
| Molecular Formula | C23H26F2N4O6S |
| Molecular Weight | 524.55 g/mol |
| Exact Mass | 524.15 |
| IUPAC Name | tert-butyl 3-[4-(1,1-difluoro-2,2-dihydroxypropoxy)-7-(1,3-thiazol-2-yl)-1,3-benzoxazol-2-yl]-3,6-diazabicyclo[3.1.1]heptane-6-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C2CC1CN(c1nc3c(OC(F)(F)C(C)(O)O)ccc(-c4nccs4)c3o1)C2 |
| InChI | InChI=1S/C23H26F2N4O6S/c1-21(2,3)35-20(30)29-12-9-13(29)11-28(10-12)19-27-16-15(34-23(24,25)22(4,31)32)6-5-14(17(16)33-19)18-26-7-8-36-18/h5-8,12-13,31-32H,9-11H2,1-4H3 |
| InChIKey | HWLDKUJIZDHPCS-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 121.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.55 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|