C9H6BrNO3S — CID 142396392
methyl 7-bromo-2-sulfanylidene-3H-1,3-benzoxazole-4-carboxylate (PubChem CID 142396392) has the molecular formula C9H6BrNO3S and a molecular weight of 288.12 g/mol. Its IUPAC name is methyl 7-bromo-2-sulfanylidene-3H-1,3-benzoxazole-4-carboxylate.
| Compound Name | methyl 7-bromo-2-sulfanylidene-3H-1,3-benzoxazole-4-carboxylate |
|---|---|
| PubChem CID | 142396392 |
| Molecular Formula | C9H6BrNO3S |
| Molecular Weight | 288.12 g/mol |
| Exact Mass | 286.93 |
| IUPAC Name | methyl 7-bromo-2-sulfanylidene-3H-1,3-benzoxazole-4-carboxylate |
| SMILES | COC(=O)c1ccc(Br)c2oc(=S)[nH]c12 |
| InChI | InChI=1S/C9H6BrNO3S/c1-13-8(12)4-2-3-5(10)7-6(4)11-9(15)14-7/h2-3H,1H3,(H,11,15) |
| InChIKey | RKJCNQNMHNHIMN-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 55.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.12 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|