C18H17F3N4O3S — CID 142396495
1-[2-(3,8-diazabicyclo[3.2.1]octan-3-yl)-7-(1,3-thiazol-2-yl)-1,3-benzoxazol-5-yl]-2,2,2-trifluoroethane-1,1-diol (PubChem CID 142396495) has the molecular formula C18H17F3N4O3S and a molecular weight of 426.42 g/mol. Its IUPAC name is 1-[2-(3,8-diazabicyclo[3.2.1]octan-3-yl)-7-(1,3-thiazol-2-yl)-1,3-benzoxazol-5-yl]-2,2,2-trifluoroethane-1,1-diol.
| Compound Name | 1-[2-(3,8-diazabicyclo[3.2.1]octan-3-yl)-7-(1,3-thiazol-2-yl)-1,3-benzoxazol-5-yl]-2,2,2-trifluoroethane-1,1-diol |
|---|---|
| PubChem CID | 142396495 |
| Molecular Formula | C18H17F3N4O3S |
| Molecular Weight | 426.42 g/mol |
| Exact Mass | 426.10 |
| IUPAC Name | 1-[2-(3,8-diazabicyclo[3.2.1]octan-3-yl)-7-(1,3-thiazol-2-yl)-1,3-benzoxazol-5-yl]-2,2,2-trifluoroethane-1,1-diol |
| SMILES | OC(O)(c1cc(-c2nccs2)c2oc(N3CC4CCC(C3)N4)nc2c1)C(F)(F)F |
| InChI | InChI=1S/C18H17F3N4O3S/c19-18(20,21)17(26,27)9-5-12(15-22-3-4-29-15)14-13(6-9)24-16(28-14)25-7-10-1-2-11(8-25)23-10/h3-6,10-11,23,26-27H,1-2,7-8H2 |
| InChIKey | WOIUKFYODMRIGR-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 94.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.42 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|