C19H22N4O3S — CID 149429693
1-[2-(3,9-diazabicyclo[3.3.1]nonan-3-yl)-7-(1,3-thiazol-2-yl)-1,3-benzoxazol-5-yl]ethane-1,1-diol (PubChem CID 149429693) has the molecular formula C19H22N4O3S and a molecular weight of 386.48 g/mol. Its IUPAC name is 1-[2-(3,9-diazabicyclo[3.3.1]nonan-3-yl)-7-(1,3-thiazol-2-yl)-1,3-benzoxazol-5-yl]ethane-1,1-diol.
| Compound Name | 1-[2-(3,9-diazabicyclo[3.3.1]nonan-3-yl)-7-(1,3-thiazol-2-yl)-1,3-benzoxazol-5-yl]ethane-1,1-diol |
|---|---|
| PubChem CID | 149429693 |
| Molecular Formula | C19H22N4O3S |
| Molecular Weight | 386.48 g/mol |
| Exact Mass | 386.14 |
| IUPAC Name | 1-[2-(3,9-diazabicyclo[3.3.1]nonan-3-yl)-7-(1,3-thiazol-2-yl)-1,3-benzoxazol-5-yl]ethane-1,1-diol |
| SMILES | CC(O)(O)c1cc(-c2nccs2)c2oc(N3CC4CCCC(C3)N4)nc2c1 |
| InChI | InChI=1S/C19H22N4O3S/c1-19(24,25)11-7-14(17-20-5-6-27-17)16-15(8-11)22-18(26-16)23-9-12-3-2-4-13(10-23)21-12/h5-8,12-13,21,24-25H,2-4,9-10H2,1H3 |
| InChIKey | YUUNKZXIQYEIEL-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 94.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.48 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|