C10H17NO2 — CID 142397521
(E)-2-(C,N-dimethylcarbonimidoyl)but-2-enoic acid;prop-1-ene (PubChem CID 142397521) has the molecular formula C10H17NO2 and a molecular weight of 183.25 g/mol. Its IUPAC name is (E)-2-(C,N-dimethylcarbonimidoyl)but-2-enoic acid;prop-1-ene.
| Compound Name | (E)-2-(C,N-dimethylcarbonimidoyl)but-2-enoic acid;prop-1-ene |
|---|---|
| PubChem CID | 142397521 |
| Molecular Formula | C10H17NO2 |
| Molecular Weight | 183.25 g/mol |
| Exact Mass | 183.13 |
| IUPAC Name | (E)-2-(C,N-dimethylcarbonimidoyl)but-2-enoic acid;prop-1-ene |
| SMILES | C/C=C(C(=O)O)\C(C)=N\C.C=CC |
| InChI | InChI=1S/C7H11NO2.C3H6/c1-4-6(7(9)10)5(2)8-3;1-3-2/h4H,1-3H3,(H,9,10);3H,1H2,2H3/b6-4+,8-5+; |
| InChIKey | GKCXNEANPLFKNQ-NFDGTPQISA-N |
| XLogP | 2.30 |
| TPSA | 49.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.25 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|