C8H11NO2 — CID 123214329
(2E)-2-ethanimidoylhexa-2,5-dienoic acid (PubChem CID 123214329) has the molecular formula C8H11NO2 and a molecular weight of 153.18 g/mol. Its IUPAC name is (2E)-2-ethanimidoylhexa-2,5-dienoic acid.
| Compound Name | (2E)-2-ethanimidoylhexa-2,5-dienoic acid |
|---|---|
| PubChem CID | 123214329 |
| Molecular Formula | C8H11NO2 |
| Molecular Weight | 153.18 g/mol |
| Exact Mass | 153.08 |
| IUPAC Name | (2E)-2-ethanimidoylhexa-2,5-dienoic acid |
| SMILES | [H]/N=C(C)/C(=C\CC=C)C(=O)O |
| InChI | InChI=1S/C8H11NO2/c1-3-4-5-7(6(2)9)8(10)11/h3,5,9H,1,4H2,2H3,(H,10,11)/b7-5+,9-6+ |
| InChIKey | JNXQARLRMSQQHX-PDTNFJSOSA-N |
| XLogP | 1.61 |
| TPSA | 61.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 153.18 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|