C8H9NO2 — CID 90903419
5-iminocyclohepta-1,6-diene-1-carboxylic acid (PubChem CID 90903419) has the molecular formula C8H9NO2 and a molecular weight of 151.16 g/mol. Its IUPAC name is 5-iminocyclohepta-1,6-diene-1-carboxylic acid.
| Compound Name | 5-iminocyclohepta-1,6-diene-1-carboxylic acid |
|---|---|
| PubChem CID | 90903419 |
| Molecular Formula | C8H9NO2 |
| Molecular Weight | 151.16 g/mol |
| Exact Mass | 151.06 |
| IUPAC Name | 5-iminocyclohepta-1,6-diene-1-carboxylic acid |
| SMILES | [H]/N=C1/C=CC(C(=O)O)=CCC1 |
| InChI | InChI=1S/C8H9NO2/c9-7-3-1-2-6(4-5-7)8(10)11/h2,4-5,9H,1,3H2,(H,10,11)/b9-7+ |
| InChIKey | JEBQFJYYTDKAIK-VQHVLOKHSA-N |
| XLogP | 1.37 |
| TPSA | 61.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 151.16 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|