C12H14N2O2 — CID 123240080
(1E,3E)-4-(3-iminopropanimidoyl)cycloocta-1,3,7-triene-1-carboxylic acid (PubChem CID 123240080) has the molecular formula C12H14N2O2 and a molecular weight of 218.26 g/mol. Its IUPAC name is (1E,3E)-4-(3-iminopropanimidoyl)cycloocta-1,3,7-triene-1-carboxylic acid.
| Compound Name | (1E,3E)-4-(3-iminopropanimidoyl)cycloocta-1,3,7-triene-1-carboxylic acid |
|---|---|
| PubChem CID | 123240080 |
| Molecular Formula | C12H14N2O2 |
| Molecular Weight | 218.26 g/mol |
| Exact Mass | 218.11 |
| IUPAC Name | (1E,3E)-4-(3-iminopropanimidoyl)cycloocta-1,3,7-triene-1-carboxylic acid |
| SMILES | [H]/N=C/CC(=N\[H])/C1=C/C=C(/C(=O)O)C=CCC1 |
| InChI | InChI=1S/C12H14N2O2/c13-8-7-11(14)9-3-1-2-4-10(6-5-9)12(15)16/h2,4-6,8,13-14H,1,3,7H2,(H,15,16)/b4-2?,9-5+,10-6+,13-8+,14-11+ |
| InChIKey | JJDHZKPYNPTSLN-IYDGEPPCSA-N |
| XLogP | 2.33 |
| TPSA | 85.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.26 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|