C11H12N2O2 — CID 143631211
(2E,5E)-6-(2-iminoethanimidoyl)-4-methylideneocta-2,5,7-trienoic acid (PubChem CID 143631211) has the molecular formula C11H12N2O2 and a molecular weight of 204.23 g/mol. Its IUPAC name is (2E,5E)-6-(2-iminoethanimidoyl)-4-methylideneocta-2,5,7-trienoic acid.
| Compound Name | (2E,5E)-6-(2-iminoethanimidoyl)-4-methylideneocta-2,5,7-trienoic acid |
|---|---|
| PubChem CID | 143631211 |
| Molecular Formula | C11H12N2O2 |
| Molecular Weight | 204.23 g/mol |
| Exact Mass | 204.09 |
| IUPAC Name | (2E,5E)-6-(2-iminoethanimidoyl)-4-methylideneocta-2,5,7-trienoic acid |
| SMILES | [H]/N=C(\C=N\[H])C(/C=C)=C/C(=C)/C=C/C(=O)O |
| InChI | InChI=1S/C11H12N2O2/c1-3-9(10(13)7-12)6-8(2)4-5-11(14)15/h3-7,12-13H,1-2H2,(H,14,15)/b5-4+,9-6+,12-7+,13-10+ |
| InChIKey | LRSHBOOEYNGJRO-GRLLUAOPSA-N |
| XLogP | 1.97 |
| TPSA | 85.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.23 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|