C10H15NO2 — CID 123533250
8-imino-5,6-dimethylocta-2,5-dienoic acid (PubChem CID 123533250) has the molecular formula C10H15NO2 and a molecular weight of 181.24 g/mol. Its IUPAC name is 8-imino-5,6-dimethylocta-2,5-dienoic acid.
| Compound Name | 8-imino-5,6-dimethylocta-2,5-dienoic acid |
|---|---|
| PubChem CID | 123533250 |
| Molecular Formula | C10H15NO2 |
| Molecular Weight | 181.24 g/mol |
| Exact Mass | 181.11 |
| IUPAC Name | 8-imino-5,6-dimethylocta-2,5-dienoic acid |
| SMILES | [H]/N=C/CC(C)=C(C)CC=CC(=O)O |
| InChI | InChI=1S/C10H15NO2/c1-8(9(2)6-7-11)4-3-5-10(12)13/h3,5,7,11H,4,6H2,1-2H3,(H,12,13)/b5-3?,9-8?,11-7+ |
| InChIKey | KNOOEGOFYZKDLT-GZJJKDHPSA-N |
| XLogP | 2.39 |
| TPSA | 61.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.24 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|