4-imino-2-methylpent-2-enoic acid

C6H9NO2 — CID 57056935

IUPAC4-imino-2-methylpent-2-enoic acid
SMILES[H]/N=C(\C)C=C(C)C(=O)O
InChIInChI=1S/C6H9NO2/c1-4(6(8)9)3-5(2)7/h3,7H,1-2H3,(H,8,9)/b4-3?,7-5+
InChIKeyXXCGKFHTDRCNNP-LDPJEHJDSA-N
MW127.14 g/mol
LogP1.06
Rot. Bonds2

About 4-imino-2-methylpent-2-enoic acid

4-imino-2-methylpent-2-enoic acid (PubChem CID 57056935) has the molecular formula C6H9NO2 and a molecular weight of 127.14 g/mol. Its IUPAC name is 4-imino-2-methylpent-2-enoic acid.

Molecular Properties

Compound Name4-imino-2-methylpent-2-enoic acid
PubChem CID57056935
Molecular FormulaC6H9NO2
Molecular Weight127.14 g/mol
Exact Mass127.06
IUPAC Name4-imino-2-methylpent-2-enoic acid
SMILES[H]/N=C(\C)C=C(C)C(=O)O
InChIInChI=1S/C6H9NO2/c1-4(6(8)9)3-5(2)7/h3,7H,1-2H3,(H,8,9)/b4-3?,7-5+
InChIKeyXXCGKFHTDRCNNP-LDPJEHJDSA-N
XLogP1.06
TPSA61.15 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds2
Heavy Atoms9
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500127.14
LogP ≤ 51.06
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}

Analyze 4-imino-2-methylpent-2-enoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-imino-2-methylpent-2-enoic acid?
The IUPAC name of 4-imino-2-methylpent-2-enoic acid (CID 57056935) is 4-imino-2-methylpent-2-enoic acid.
What is the SMILES notation for 4-imino-2-methylpent-2-enoic acid?
The canonical SMILES for 4-imino-2-methylpent-2-enoic acid is [H]/N=C(\C)C=C(C)C(=O)O.
What is the InChIKey of 4-imino-2-methylpent-2-enoic acid?
The InChIKey is XXCGKFHTDRCNNP-LDPJEHJDSA-N. The full InChI is InChI=1S/C6H9NO2/c1-4(6(8)9)3-5(2)7/h3,7H,1-2H3,(H,8,9)/b4-3?,7-5+.
What are the key properties of 4-imino-2-methylpent-2-enoic acid?
4-imino-2-methylpent-2-enoic acid has a molecular weight of 127.14 g/mol, XLogP of 1.06, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-imino-2-methylpent-2-enoic acid is sourced from PubChem (CID 57056935), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).