(2E,5E)-4-bromo-2-ethanimidoylocta-2,5,7-trienoic acid

C10H12BrNO2 — CID 90921150

IUPAC(2E,5E)-4-bromo-2-ethanimidoylocta-2,5,7-trienoic acid
SMILES[H]/N=C(C)/C(=C\C(Br)/C=C/C=C)C(=O)O
InChIInChI=1S/C10H12BrNO2/c1-3-4-5-8(11)6-9(7(2)12)10(13)14/h3-6,8,12H,1H2,2H3,(H,13,14)/b5-4+,9-6+,12-7+
InChIKeyLNRDXYZLGZTCMY-RHEVVKIYSA-N
MW258.12 g/mol
LogP2.54
Rot. Bonds5

About (2E,5E)-4-bromo-2-ethanimidoylocta-2,5,7-trienoic acid

(2E,5E)-4-bromo-2-ethanimidoylocta-2,5,7-trienoic acid (PubChem CID 90921150) has the molecular formula C10H12BrNO2 and a molecular weight of 258.12 g/mol. Its IUPAC name is (2E,5E)-4-bromo-2-ethanimidoylocta-2,5,7-trienoic acid.

Molecular Properties

Compound Name(2E,5E)-4-bromo-2-ethanimidoylocta-2,5,7-trienoic acid
PubChem CID90921150
Molecular FormulaC10H12BrNO2
Molecular Weight258.12 g/mol
Exact Mass257.01
IUPAC Name(2E,5E)-4-bromo-2-ethanimidoylocta-2,5,7-trienoic acid
SMILES[H]/N=C(C)/C(=C\C(Br)/C=C/C=C)C(=O)O
InChIInChI=1S/C10H12BrNO2/c1-3-4-5-8(11)6-9(7(2)12)10(13)14/h3-6,8,12H,1H2,2H3,(H,13,14)/b5-4+,9-6+,12-7+
InChIKeyLNRDXYZLGZTCMY-RHEVVKIYSA-N
XLogP2.54
TPSA61.15 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds5
Heavy Atoms14
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500258.12
LogP ≤ 52.54
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}

Analyze (2E,5E)-4-bromo-2-ethanimidoylocta-2,5,7-trienoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (2E,5E)-4-bromo-2-ethanimidoylocta-2,5,7-trienoic acid?
The IUPAC name of (2E,5E)-4-bromo-2-ethanimidoylocta-2,5,7-trienoic acid (CID 90921150) is (2E,5E)-4-bromo-2-ethanimidoylocta-2,5,7-trienoic acid.
What is the SMILES notation for (2E,5E)-4-bromo-2-ethanimidoylocta-2,5,7-trienoic acid?
The canonical SMILES for (2E,5E)-4-bromo-2-ethanimidoylocta-2,5,7-trienoic acid is [H]/N=C(C)/C(=C\C(Br)/C=C/C=C)C(=O)O.
What is the InChIKey of (2E,5E)-4-bromo-2-ethanimidoylocta-2,5,7-trienoic acid?
The InChIKey is LNRDXYZLGZTCMY-RHEVVKIYSA-N. The full InChI is InChI=1S/C10H12BrNO2/c1-3-4-5-8(11)6-9(7(2)12)10(13)14/h3-6,8,12H,1H2,2H3,(H,13,14)/b5-4+,9-6+,12-7+.
What are the key properties of (2E,5E)-4-bromo-2-ethanimidoylocta-2,5,7-trienoic acid?
(2E,5E)-4-bromo-2-ethanimidoylocta-2,5,7-trienoic acid has a molecular weight of 258.12 g/mol, XLogP of 2.54, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2E,5E)-4-bromo-2-ethanimidoylocta-2,5,7-trienoic acid is sourced from PubChem (CID 90921150), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).