C10H12BrNO2 — CID 90921150
(2E,5E)-4-bromo-2-ethanimidoylocta-2,5,7-trienoic acid (PubChem CID 90921150) has the molecular formula C10H12BrNO2 and a molecular weight of 258.12 g/mol. Its IUPAC name is (2E,5E)-4-bromo-2-ethanimidoylocta-2,5,7-trienoic acid.
| Compound Name | (2E,5E)-4-bromo-2-ethanimidoylocta-2,5,7-trienoic acid |
|---|---|
| PubChem CID | 90921150 |
| Molecular Formula | C10H12BrNO2 |
| Molecular Weight | 258.12 g/mol |
| Exact Mass | 257.01 |
| IUPAC Name | (2E,5E)-4-bromo-2-ethanimidoylocta-2,5,7-trienoic acid |
| SMILES | [H]/N=C(C)/C(=C\C(Br)/C=C/C=C)C(=O)O |
| InChI | InChI=1S/C10H12BrNO2/c1-3-4-5-8(11)6-9(7(2)12)10(13)14/h3-6,8,12H,1H2,2H3,(H,13,14)/b5-4+,9-6+,12-7+ |
| InChIKey | LNRDXYZLGZTCMY-RHEVVKIYSA-N |
| XLogP | 2.54 |
| TPSA | 61.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.12 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|