7-imino-5-methylcyclohepta-1,3,5-triene-1-carboxylic acid

C9H9NO2 — CID 123908106

IUPAC7-imino-5-methylcyclohepta-1,3,5-triene-1-carboxylic acid
SMILES[H]/N=c1\cc(C)cccc1C(=O)O
InChIInChI=1S/C9H9NO2/c1-6-3-2-4-7(9(11)12)8(10)5-6/h2-5,10H,1H3,(H,11,12)/b10-8+
InChIKeyFWEUIBQSXSYEFY-CSKARUKUSA-N
MW163.18 g/mol
LogP1.17
Rot. Bonds1

About 7-imino-5-methylcyclohepta-1,3,5-triene-1-carboxylic acid

7-imino-5-methylcyclohepta-1,3,5-triene-1-carboxylic acid (PubChem CID 123908106) has the molecular formula C9H9NO2 and a molecular weight of 163.18 g/mol. Its IUPAC name is 7-imino-5-methylcyclohepta-1,3,5-triene-1-carboxylic acid.

Molecular Properties

Compound Name7-imino-5-methylcyclohepta-1,3,5-triene-1-carboxylic acid
PubChem CID123908106
Molecular FormulaC9H9NO2
Molecular Weight163.18 g/mol
Exact Mass163.06
IUPAC Name7-imino-5-methylcyclohepta-1,3,5-triene-1-carboxylic acid
SMILES[H]/N=c1\cc(C)cccc1C(=O)O
InChIInChI=1S/C9H9NO2/c1-6-3-2-4-7(9(11)12)8(10)5-6/h2-5,10H,1H3,(H,11,12)/b10-8+
InChIKeyFWEUIBQSXSYEFY-CSKARUKUSA-N
XLogP1.17
TPSA61.15 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds1
Heavy Atoms12
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500163.18
LogP ≤ 51.17
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Analyze 7-imino-5-methylcyclohepta-1,3,5-triene-1-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 7-imino-5-methylcyclohepta-1,3,5-triene-1-carboxylic acid?
The IUPAC name of 7-imino-5-methylcyclohepta-1,3,5-triene-1-carboxylic acid (CID 123908106) is 7-imino-5-methylcyclohepta-1,3,5-triene-1-carboxylic acid.
What is the SMILES notation for 7-imino-5-methylcyclohepta-1,3,5-triene-1-carboxylic acid?
The canonical SMILES for 7-imino-5-methylcyclohepta-1,3,5-triene-1-carboxylic acid is [H]/N=c1\cc(C)cccc1C(=O)O.
What is the InChIKey of 7-imino-5-methylcyclohepta-1,3,5-triene-1-carboxylic acid?
The InChIKey is FWEUIBQSXSYEFY-CSKARUKUSA-N. The full InChI is InChI=1S/C9H9NO2/c1-6-3-2-4-7(9(11)12)8(10)5-6/h2-5,10H,1H3,(H,11,12)/b10-8+.
What are the key properties of 7-imino-5-methylcyclohepta-1,3,5-triene-1-carboxylic acid?
7-imino-5-methylcyclohepta-1,3,5-triene-1-carboxylic acid has a molecular weight of 163.18 g/mol, XLogP of 1.17, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7-imino-5-methylcyclohepta-1,3,5-triene-1-carboxylic acid is sourced from PubChem (CID 123908106), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).