C10H22O4 — CID 142398679
(1S)-1-(oxolan-2-yl)propan-1-ol;propane-2,2-diol (PubChem CID 142398679) has the molecular formula C10H22O4 and a molecular weight of 206.28 g/mol. Its IUPAC name is (1S)-1-(oxolan-2-yl)propan-1-ol;propane-2,2-diol.
| Compound Name | (1S)-1-(oxolan-2-yl)propan-1-ol;propane-2,2-diol |
|---|---|
| PubChem CID | 142398679 |
| Molecular Formula | C10H22O4 |
| Molecular Weight | 206.28 g/mol |
| Exact Mass | 206.15 |
| IUPAC Name | (1S)-1-(oxolan-2-yl)propan-1-ol;propane-2,2-diol |
| SMILES | CC(C)(O)O.CC[C@H](O)C1CCCO1 |
| InChI | InChI=1S/C7H14O2.C3H8O2/c1-2-6(8)7-4-3-5-9-7;1-3(2,4)5/h6-8H,2-5H2,1H3;4-5H,1-2H3/t6-,7?;/m0./s1 |
| InChIKey | IYFWYSDSSDJKAO-OXIGJRIQSA-N |
| XLogP | 0.64 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.28 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|