C9H17IO — CID 101448709
(2S)-2-[(1S)-1-iodo-2,2-dimethylpropyl]oxolane (PubChem CID 101448709) has the molecular formula C9H17IO and a molecular weight of 268.14 g/mol. Its IUPAC name is (2S)-2-[(1S)-1-iodo-2,2-dimethylpropyl]oxolane.
| Compound Name | (2S)-2-[(1S)-1-iodo-2,2-dimethylpropyl]oxolane |
|---|---|
| PubChem CID | 101448709 |
| Molecular Formula | C9H17IO |
| Molecular Weight | 268.14 g/mol |
| Exact Mass | 268.03 |
| IUPAC Name | (2S)-2-[(1S)-1-iodo-2,2-dimethylpropyl]oxolane |
| SMILES | CC(C)(C)[C@H](I)[C@@H]1CCCO1 |
| InChI | InChI=1S/C9H17IO/c1-9(2,3)8(10)7-5-4-6-11-7/h7-8H,4-6H2,1-3H3/t7-,8+/m0/s1 |
| InChIKey | GIAGVAWAFMCPPL-JGVFFNPUSA-N |
| XLogP | 3.02 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.14 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|