About 2-(oxolan-2-yl)butanal
2-(oxolan-2-yl)butanal (PubChem CID 84716261) has the molecular formula C8H14O2
and a molecular weight of 142.20 g/mol. Its IUPAC name is 2-(oxolan-2-yl)butanal.
Molecular Properties
| Compound Name | 2-(oxolan-2-yl)butanal |
| PubChem CID | 84716261 |
| Molecular Formula | C8H14O2 |
| Molecular Weight | 142.20 g/mol |
| Exact Mass | 142.10 |
| IUPAC Name | 2-(oxolan-2-yl)butanal |
| SMILES | CCC(C=O)C1CCCO1 |
| InChI | InChI=1S/C8H14O2/c1-2-7(6-9)8-4-3-5-10-8/h6-8H,2-5H2,1H3 |
| InChIKey | CBHUCYIBDKZHGB-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 142.20 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 2-(oxolan-2-yl)butanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(oxolan-2-yl)butanal?
The IUPAC name of 2-(oxolan-2-yl)butanal (CID 84716261) is 2-(oxolan-2-yl)butanal.
What is the SMILES notation for 2-(oxolan-2-yl)butanal?
The canonical SMILES for 2-(oxolan-2-yl)butanal is CCC(C=O)C1CCCO1.
What is the InChIKey of 2-(oxolan-2-yl)butanal?
The InChIKey is CBHUCYIBDKZHGB-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14O2/c1-2-7(6-9)8-4-3-5-10-8/h6-8H,2-5H2,1H3.
What are the key properties of 2-(oxolan-2-yl)butanal?
2-(oxolan-2-yl)butanal has a molecular weight of 142.20 g/mol, XLogP of 1.39, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(oxolan-2-yl)butanal is sourced from PubChem (CID 84716261), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).