About 1-(oxolan-2-yl)ethanol;propanal
1-(oxolan-2-yl)ethanol;propanal (PubChem CID 174771711) has the molecular formula C9H18O3
and a molecular weight of 174.24 g/mol. Its IUPAC name is 1-(oxolan-2-yl)ethanol;propanal.
Molecular Properties
| Compound Name | 1-(oxolan-2-yl)ethanol;propanal |
| PubChem CID | 174771711 |
| Molecular Formula | C9H18O3 |
| Molecular Weight | 174.24 g/mol |
| Exact Mass | 174.13 |
| IUPAC Name | 1-(oxolan-2-yl)ethanol;propanal |
| SMILES | CC(O)C1CCCO1.CCC=O |
| InChI | InChI=1S/C6H12O2.C3H6O/c1-5(7)6-3-2-4-8-6;1-2-3-4/h5-7H,2-4H2,1H3;3H,2H2,1H3 |
| InChIKey | XIZFYYQRXAQEPA-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.24 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 1-(oxolan-2-yl)ethanol;propanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(oxolan-2-yl)ethanol;propanal?
The IUPAC name of 1-(oxolan-2-yl)ethanol;propanal (CID 174771711) is 1-(oxolan-2-yl)ethanol;propanal.
What is the SMILES notation for 1-(oxolan-2-yl)ethanol;propanal?
The canonical SMILES for 1-(oxolan-2-yl)ethanol;propanal is CC(O)C1CCCO1.CCC=O.
What is the InChIKey of 1-(oxolan-2-yl)ethanol;propanal?
The InChIKey is XIZFYYQRXAQEPA-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12O2.C3H6O/c1-5(7)6-3-2-4-8-6;1-2-3-4/h5-7H,2-4H2,1H3;3H,2H2,1H3.
What are the key properties of 1-(oxolan-2-yl)ethanol;propanal?
1-(oxolan-2-yl)ethanol;propanal has a molecular weight of 174.24 g/mol, XLogP of 1.14, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(oxolan-2-yl)ethanol;propanal is sourced from PubChem (CID 174771711), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).