C17H25FOS — CID 142399334
4-(2-but-3-enylsulfanylpropan-2-yl)-1-fluoro-2-(2-methylpropoxy)benzene (PubChem CID 142399334) has the molecular formula C17H25FOS and a molecular weight of 296.45 g/mol. Its IUPAC name is 4-(2-but-3-enylsulfanylpropan-2-yl)-1-fluoro-2-(2-methylpropoxy)benzene.
| Compound Name | 4-(2-but-3-enylsulfanylpropan-2-yl)-1-fluoro-2-(2-methylpropoxy)benzene |
|---|---|
| PubChem CID | 142399334 |
| Molecular Formula | C17H25FOS |
| Molecular Weight | 296.45 g/mol |
| Exact Mass | 296.16 |
| IUPAC Name | 4-(2-but-3-enylsulfanylpropan-2-yl)-1-fluoro-2-(2-methylpropoxy)benzene |
| SMILES | C=CCCSC(C)(C)c1ccc(F)c(OCC(C)C)c1 |
| InChI | InChI=1S/C17H25FOS/c1-6-7-10-20-17(4,5)14-8-9-15(18)16(11-14)19-12-13(2)3/h6,8-9,11,13H,1,7,10,12H2,2-5H3 |
| InChIKey | AAVVPIWNFOMPGX-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.45 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|