C22H13F8N3O2 — CID 142401392
2-methoxy-5-[6-[3-(1,1,2,2,2-pentafluoroethyl)phenyl]-2-(trifluoromethyl)imidazo[1,2-a]pyrazin-3-yl]phenol (PubChem CID 142401392) has the molecular formula C22H13F8N3O2 and a molecular weight of 503.35 g/mol. Its IUPAC name is 2-methoxy-5-[6-[3-(1,1,2,2,2-pentafluoroethyl)phenyl]-2-(trifluoromethyl)imidazo[1,2-a]pyrazin-3-yl]phenol.
| Compound Name | 2-methoxy-5-[6-[3-(1,1,2,2,2-pentafluoroethyl)phenyl]-2-(trifluoromethyl)imidazo[1,2-a]pyrazin-3-yl]phenol |
|---|---|
| PubChem CID | 142401392 |
| Molecular Formula | C22H13F8N3O2 |
| Molecular Weight | 503.35 g/mol |
| Exact Mass | 503.09 |
| IUPAC Name | 2-methoxy-5-[6-[3-(1,1,2,2,2-pentafluoroethyl)phenyl]-2-(trifluoromethyl)imidazo[1,2-a]pyrazin-3-yl]phenol |
| SMILES | COc1ccc(-c2c(C(F)(F)F)nc3cnc(-c4cccc(C(F)(F)C(F)(F)F)c4)cn23)cc1O |
| InChI | InChI=1S/C22H13F8N3O2/c1-35-16-6-5-12(8-15(16)34)18-19(21(25,26)27)32-17-9-31-14(10-33(17)18)11-3-2-4-13(7-11)20(23,24)22(28,29)30/h2-10,34H,1H3 |
| InChIKey | IJQZGKTWCNXUOQ-UHFFFAOYSA-N |
| XLogP | 6.45 |
| TPSA | 59.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.35 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|