C22H15F6N3O — CID 160542123
3-fluoro-5-methyl-4-[2-methyl-6-[3-(1,1,2,2,2-pentafluoroethyl)phenyl]imidazo[1,2-a]pyrazin-3-yl]phenol (PubChem CID 160542123) has the molecular formula C22H15F6N3O and a molecular weight of 451.37 g/mol. Its IUPAC name is 3-fluoro-5-methyl-4-[2-methyl-6-[3-(1,1,2,2,2-pentafluoroethyl)phenyl]imidazo[1,2-a]pyrazin-3-yl]phenol.
| Compound Name | 3-fluoro-5-methyl-4-[2-methyl-6-[3-(1,1,2,2,2-pentafluoroethyl)phenyl]imidazo[1,2-a]pyrazin-3-yl]phenol |
|---|---|
| PubChem CID | 160542123 |
| Molecular Formula | C22H15F6N3O |
| Molecular Weight | 451.37 g/mol |
| Exact Mass | 451.11 |
| IUPAC Name | 3-fluoro-5-methyl-4-[2-methyl-6-[3-(1,1,2,2,2-pentafluoroethyl)phenyl]imidazo[1,2-a]pyrazin-3-yl]phenol |
| SMILES | Cc1cc(O)cc(F)c1-c1c(C)nc2cnc(-c3cccc(C(F)(F)C(F)(F)F)c3)cn12 |
| InChI | InChI=1S/C22H15F6N3O/c1-11-6-15(32)8-16(23)19(11)20-12(2)30-18-9-29-17(10-31(18)20)13-4-3-5-14(7-13)21(24,25)22(26,27)28/h3-10,32H,1-2H3 |
| InChIKey | CAMZBFMIEYCMSD-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 50.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.37 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|