C20H24N2O5 — CID 142401642
2-[(2,4-dimethoxyphenyl)methyl-methylamino]-N-(2-formyl-4-methoxyphenyl)acetamide (PubChem CID 142401642) has the molecular formula C20H24N2O5 and a molecular weight of 372.42 g/mol. Its IUPAC name is 2-[(2,4-dimethoxyphenyl)methyl-methylamino]-N-(2-formyl-4-methoxyphenyl)acetamide.
| Compound Name | 2-[(2,4-dimethoxyphenyl)methyl-methylamino]-N-(2-formyl-4-methoxyphenyl)acetamide |
|---|---|
| PubChem CID | 142401642 |
| Molecular Formula | C20H24N2O5 |
| Molecular Weight | 372.42 g/mol |
| Exact Mass | 372.17 |
| IUPAC Name | 2-[(2,4-dimethoxyphenyl)methyl-methylamino]-N-(2-formyl-4-methoxyphenyl)acetamide |
| SMILES | COc1ccc(NC(=O)CN(C)Cc2ccc(OC)cc2OC)c(C=O)c1 |
| InChI | InChI=1S/C20H24N2O5/c1-22(11-14-5-6-17(26-3)10-19(14)27-4)12-20(24)21-18-8-7-16(25-2)9-15(18)13-23/h5-10,13H,11-12H2,1-4H3,(H,21,24) |
| InChIKey | OGCZFPJNQSWTKM-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.42 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|