About ethyl 2-[bromo(triphenyl)-λ5-phosphanyl]-3-(2-nitrophenyl)propanoate
ethyl 2-[bromo(triphenyl)-λ5-phosphanyl]-3-(2-nitrophenyl)propanoate (PubChem CID 142403417) has the molecular formula C29H27BrNO4P
and a molecular weight of 564.42 g/mol. Its IUPAC name is ethyl 2-[bromo(triphenyl)-λ5-phosphanyl]-3-(2-nitrophenyl)propanoate.
Molecular Properties
| Compound Name | ethyl 2-[bromo(triphenyl)-λ5-phosphanyl]-3-(2-nitrophenyl)propanoate |
| PubChem CID | 142403417 |
| Molecular Formula | C29H27BrNO4P |
| Molecular Weight | 564.42 g/mol |
| Exact Mass | 563.09 |
| IUPAC Name | ethyl 2-[bromo(triphenyl)-λ5-phosphanyl]-3-(2-nitrophenyl)propanoate |
| SMILES | CCOC(=O)C(Cc1ccccc1[N+](=O)[O-])P(Br)(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C29H27BrNO4P/c1-2-35-29(32)28(22-23-14-12-13-21-27(23)31(33)34)36(30,24-15-6-3-7-16-24,25-17-8-4-9-18-25)26-19-10-5-11-20-26/h3-21,28H,2,22H2,1H3 |
| InChIKey | XAXMOHIKAMOOIJ-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 69.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 564.42 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze ethyl 2-[bromo(triphenyl)-λ5-phosphanyl]-3-(2-nitrophenyl)propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-[bromo(triphenyl)-λ5-phosphanyl]-3-(2-nitrophenyl)propanoate?
The IUPAC name of ethyl 2-[bromo(triphenyl)-λ5-phosphanyl]-3-(2-nitrophenyl)propanoate (CID 142403417) is ethyl 2-[bromo(triphenyl)-λ5-phosphanyl]-3-(2-nitrophenyl)propanoate.
What is the SMILES notation for ethyl 2-[bromo(triphenyl)-λ5-phosphanyl]-3-(2-nitrophenyl)propanoate?
The canonical SMILES for ethyl 2-[bromo(triphenyl)-λ5-phosphanyl]-3-(2-nitrophenyl)propanoate is CCOC(=O)C(Cc1ccccc1[N+](=O)[O-])P(Br)(c1ccccc1)(c1ccccc1)c1ccccc1.
What is the InChIKey of ethyl 2-[bromo(triphenyl)-λ5-phosphanyl]-3-(2-nitrophenyl)propanoate?
The InChIKey is XAXMOHIKAMOOIJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C29H27BrNO4P/c1-2-35-29(32)28(22-23-14-12-13-21-27(23)31(33)34)36(30,24-15-6-3-7-16-24,25-17-8-4-9-18-25)26-19-10-5-11-20-26/h3-21,28H,2,22H2,1H3.
What are the key properties of ethyl 2-[bromo(triphenyl)-λ5-phosphanyl]-3-(2-nitrophenyl)propanoate?
ethyl 2-[bromo(triphenyl)-λ5-phosphanyl]-3-(2-nitrophenyl)propanoate has a molecular weight of 564.42 g/mol, XLogP of 5.91, 9 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-[bromo(triphenyl)-λ5-phosphanyl]-3-(2-nitrophenyl)propanoate is sourced from PubChem (CID 142403417), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).