C23H33N5O2S — CID 142405166
1-ethoxy-3-(1H-indol-3-yl)-N-methylpropan-2-amine;2-(4-methylpiperazin-1-yl)-1,3-thiazole-5-carbaldehyde (PubChem CID 142405166) has the molecular formula C23H33N5O2S and a molecular weight of 443.62 g/mol. Its IUPAC name is 1-ethoxy-3-(1H-indol-3-yl)-N-methylpropan-2-amine;2-(4-methylpiperazin-1-yl)-1,3-thiazole-5-carbaldehyde.
| Compound Name | 1-ethoxy-3-(1H-indol-3-yl)-N-methylpropan-2-amine;2-(4-methylpiperazin-1-yl)-1,3-thiazole-5-carbaldehyde |
|---|---|
| PubChem CID | 142405166 |
| Molecular Formula | C23H33N5O2S |
| Molecular Weight | 443.62 g/mol |
| Exact Mass | 443.24 |
| IUPAC Name | 1-ethoxy-3-(1H-indol-3-yl)-N-methylpropan-2-amine;2-(4-methylpiperazin-1-yl)-1,3-thiazole-5-carbaldehyde |
| SMILES | CCOCC(Cc1c[nH]c2ccccc12)NC.CN1CCN(c2ncc(C=O)s2)CC1 |
| InChI | InChI=1S/C14H20N2O.C9H13N3OS/c1-3-17-10-12(15-2)8-11-9-16-14-7-5-4-6-13(11)14;1-11-2-4-12(5-3-11)9-10-6-8(7-13)14-9/h4-7,9,12,15-16H,3,8,10H2,1-2H3;6-7H,2-5H2,1H3 |
| InChIKey | LBJDSWUFRSCPPB-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 73.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.62 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|